C19H31N3O4 — CID 54312875
1-(1-acetylpiperidin-4-yl)-3-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidin-2-one (PubChem CID 54312875) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidin-2-one.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidin-2-one |
|---|---|
| PubChem CID | 54312875 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-[2-(4-hydroxypiperidin-1-yl)-2-oxoethyl]piperidin-2-one |
| SMILES | CC(=O)N1CCC(N2CCCC(CC(=O)N3CCC(O)CC3)C2=O)CC1 |
| InChI | InChI=1S/C19H31N3O4/c1-14(23)20-9-4-16(5-10-20)22-8-2-3-15(19(22)26)13-18(25)21-11-6-17(24)7-12-21/h15-17,24H,2-13H2,1H3 |
| InChIKey | SMCYHCOYOXWCHV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |