C12H14FO2W+ — CID 20590710
2-[(4-fluorophenoxy)methyl]-5-methanidyloxolane;tungsten(2+) (PubChem CID 20590710) has the molecular formula C12H14FO2W+ and a molecular weight of 393.08 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-5-methanidyloxolane;tungsten(2+).
| Compound Name | 2-[(4-fluorophenoxy)methyl]-5-methanidyloxolane;tungsten(2+) |
|---|---|
| PubChem CID | 20590710 |
| Molecular Formula | C12H14FO2W+ |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-5-methanidyloxolane;tungsten(2+) |
| SMILES | [CH2-]C1CCC(COc2ccc(F)cc2)O1.[W+2] |
| InChI | InChI=1S/C12H14FO2.W/c1-9-2-5-12(15-9)8-14-11-6-3-10(13)4-7-11;/h3-4,6-7,9,12H,1-2,5,8H2;/q-1;+2 |
| InChIKey | QCJAYRJFXBXDCY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|