C13H18FNO2 — CID 174187392
N,N-diethyl-3-[(4-fluorophenoxy)methyl]oxiran-2-amine (PubChem CID 174187392) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is N,N-diethyl-3-[(4-fluorophenoxy)methyl]oxiran-2-amine.
| Compound Name | N,N-diethyl-3-[(4-fluorophenoxy)methyl]oxiran-2-amine |
|---|---|
| PubChem CID | 174187392 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N,N-diethyl-3-[(4-fluorophenoxy)methyl]oxiran-2-amine |
| SMILES | CCN(CC)C1OC1COc1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO2/c1-3-15(4-2)13-12(17-13)9-16-11-7-5-10(14)6-8-11/h5-8,12-13H,3-4,9H2,1-2H3 |
| InChIKey | GWXQPHKXCQADAP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|