C9H7FN2O2S — CID 170923839
2-[(4-fluorophenoxy)methyl]-2H-1,3,4-oxadiazole-5-thione (PubChem CID 170923839) has the molecular formula C9H7FN2O2S and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-2H-1,3,4-oxadiazole-5-thione.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-2H-1,3,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 170923839 |
| Molecular Formula | C9H7FN2O2S |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-2H-1,3,4-oxadiazole-5-thione |
| SMILES | Fc1ccc(OCC2N=NC(=S)O2)cc1 |
| InChI | InChI=1S/C9H7FN2O2S/c10-6-1-3-7(4-2-6)13-5-8-11-12-9(15)14-8/h1-4,8H,5H2 |
| InChIKey | YXAVIAISTVQFLG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|