C13H16N2O2S — CID 170924004
2-[(4-tert-butylphenoxy)methyl]-2H-1,3,4-oxadiazole-5-thione (PubChem CID 170924004) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-[(4-tert-butylphenoxy)methyl]-2H-1,3,4-oxadiazole-5-thione.
| Compound Name | 2-[(4-tert-butylphenoxy)methyl]-2H-1,3,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 170924004 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-[(4-tert-butylphenoxy)methyl]-2H-1,3,4-oxadiazole-5-thione |
| SMILES | CC(C)(C)c1ccc(OCC2N=NC(=S)O2)cc1 |
| InChI | InChI=1S/C13H16N2O2S/c1-13(2,3)9-4-6-10(7-5-9)16-8-11-14-15-12(18)17-11/h4-7,11H,8H2,1-3H3 |
| InChIKey | DECJWZCIMSJUGL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|