C29H40O4S — CID 132536002
(3aS,4S,6S,6aS)-4,6-bis[(4-tert-butylphenoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole (PubChem CID 132536002) has the molecular formula C29H40O4S and a molecular weight of 484.70 g/mol. Its IUPAC name is (3aS,4S,6S,6aS)-4,6-bis[(4-tert-butylphenoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4S,6S,6aS)-4,6-bis[(4-tert-butylphenoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 132536002 |
| Molecular Formula | C29H40O4S |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (3aS,4S,6S,6aS)-4,6-bis[(4-tert-butylphenoxy)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@H](COc1ccc(C(C)(C)C)cc1)S[C@H]2COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H40O4S/c1-27(2,3)19-9-13-21(14-10-19)30-17-23-25-26(33-29(7,8)32-25)24(34-23)18-31-22-15-11-20(12-16-22)28(4,5)6/h9-16,23-26H,17-18H2,1-8H3/t23-,24-,25+,26+/m0/s1 |
| InChIKey | BTJVHNBANJVRJA-QEGGNFSNSA-N |
| XLogP | 6.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |