C27H32Br2ClN4O3+ — CID 20592491
4-[2-[4-(6,15-dibromo-13-chloro-4-hydroxy-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-oxoethyl]piperidine-1-carboxamide (PubChem CID 20592491) has the molecular formula C27H32Br2ClN4O3+ and a molecular weight of 655.84 g/mol. Its IUPAC name is 4-[2-[4-(6,15-dibromo-13-chloro-4-hydroxy-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-oxoethyl]piperidine-1-carboxamide.
| Compound Name | 4-[2-[4-(6,15-dibromo-13-chloro-4-hydroxy-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-oxoethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20592491 |
| Molecular Formula | C27H32Br2ClN4O3+ |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 653.05 |
| IUPAC Name | 4-[2-[4-(6,15-dibromo-13-chloro-4-hydroxy-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-oxoethyl]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(CC(=O)N2CCC(C3c4c(Br)cc(Cl)cc4CCc4cc(Br)c[n+](O)c43)CC2)CC1 |
| InChI | InChI=1S/C27H31Br2ClN4O3/c28-20-12-19-2-1-18-13-21(30)14-22(29)24(18)25(26(19)34(37)15-20)17-5-9-32(10-6-17)23(35)11-16-3-7-33(8-4-16)27(31)36/h12-17,25H,1-11H2,(H2-,31,36,37)/p+1 |
| InChIKey | KNSCTAPNUKFUIG-UHFFFAOYSA-O |
| XLogP | 5.04 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|