C27H33Br2N2O3+ — CID 59954882
1-[4-[(2R)-6,15-dibromo-4-hydroxy-13-methyl-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-(oxan-4-yl)ethanone (PubChem CID 59954882) has the molecular formula C27H33Br2N2O3+ and a molecular weight of 593.38 g/mol. Its IUPAC name is 1-[4-[(2R)-6,15-dibromo-4-hydroxy-13-methyl-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-(oxan-4-yl)ethanone.
| Compound Name | 1-[4-[(2R)-6,15-dibromo-4-hydroxy-13-methyl-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 59954882 |
| Molecular Formula | C27H33Br2N2O3+ |
| Molecular Weight | 593.38 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | 1-[4-[(2R)-6,15-dibromo-4-hydroxy-13-methyl-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-(oxan-4-yl)ethanone |
| SMILES | Cc1cc(Br)c2c(c1)CCc1cc(Br)c[n+](O)c1[C@@H]2C1CCN(C(=O)CC2CCOCC2)CC1 |
| InChI | InChI=1S/C27H33Br2N2O3/c1-17-12-20-2-3-21-15-22(28)16-31(33)27(21)26(25(20)23(29)13-17)19-4-8-30(9-5-19)24(32)14-18-6-10-34-11-7-18/h12-13,15-16,18-19,26,33H,2-11,14H2,1H3/q+1/t26-/m1/s1 |
| InChIKey | ZKBZTJHJSNFMGP-AREMUKBSSA-N |
| XLogP | 5.33 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|