C28H32Br2N2O2 — CID 59951856
2-[2-[4-[(2R)-6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]cyclohexan-1-one (PubChem CID 59951856) has the molecular formula C28H32Br2N2O2 and a molecular weight of 588.38 g/mol. Its IUPAC name is 2-[2-[4-[(2R)-6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]cyclohexan-1-one.
| Compound Name | 2-[2-[4-[(2R)-6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 59951856 |
| Molecular Formula | C28H32Br2N2O2 |
| Molecular Weight | 588.38 g/mol |
| Exact Mass | 586.08 |
| IUPAC Name | 2-[2-[4-[(2R)-6,15-dibromo-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]piperidin-1-yl]-2-oxoethyl]cyclohexan-1-one |
| SMILES | Cc1cc(Br)c2c(c1)CCc1cc(Br)cnc1[C@@H]2C1CCN(C(=O)CC2CCCCC2=O)CC1 |
| InChI | InChI=1S/C28H32Br2N2O2/c1-17-12-20-6-7-21-14-22(29)16-31-28(21)27(26(20)23(30)13-17)18-8-10-32(11-9-18)25(34)15-19-4-2-3-5-24(19)33/h12-14,16,18-19,27H,2-11,15H2,1H3/t19?,27-/m1/s1 |
| InChIKey | TXHZCZNRUVSFTC-MLARANPPSA-N |
| XLogP | 6.53 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.38 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |