C27H27Br2ClN3O+ — CID 20592554
1-[4-(6,12-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-(1-methylpyridin-1-ium-4-yl)ethanone (PubChem CID 20592554) has the molecular formula C27H27Br2ClN3O+ and a molecular weight of 604.79 g/mol. Its IUPAC name is 1-[4-(6,12-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-(1-methylpyridin-1-ium-4-yl)ethanone.
| Compound Name | 1-[4-(6,12-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-(1-methylpyridin-1-ium-4-yl)ethanone |
|---|---|
| PubChem CID | 20592554 |
| Molecular Formula | C27H27Br2ClN3O+ |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 602.02 |
| IUPAC Name | 1-[4-(6,12-dibromo-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-(1-methylpyridin-1-ium-4-yl)ethanone |
| SMILES | C[n+]1ccc(CC(=O)N2CCC(C3c4ccc(Cl)c(Br)c4CCc4cc(Br)cnc43)CC2)cc1 |
| InChI | InChI=1S/C27H27Br2ClN3O/c1-32-10-6-17(7-11-32)14-24(34)33-12-8-18(9-13-33)25-21-4-5-23(30)26(29)22(21)3-2-19-15-20(28)16-31-27(19)25/h4-7,10-11,15-16,18,25H,2-3,8-9,12-14H2,1H3/q+1 |
| InChIKey | DQWFJJCNPMPSSV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|