C31H36N3O3+ — CID 22965909
1-[4-(6-cyclopropyl-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-(1-hydroxypyridin-1-ium-4-yl)ethanone (PubChem CID 22965909) has the molecular formula C31H36N3O3+ and a molecular weight of 498.65 g/mol. Its IUPAC name is 1-[4-(6-cyclopropyl-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-(1-hydroxypyridin-1-ium-4-yl)ethanone.
| Compound Name | 1-[4-(6-cyclopropyl-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-(1-hydroxypyridin-1-ium-4-yl)ethanone |
|---|---|
| PubChem CID | 22965909 |
| Molecular Formula | C31H36N3O3+ |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 1-[4-(6-cyclopropyl-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperidin-1-yl]-2-(1-hydroxypyridin-1-ium-4-yl)ethanone |
| SMILES | COc1cc(C)cc2c1C(C1CCN(C(=O)Cc3cc[n+](O)cc3)CC1)c1ncc(C3CC3)cc1CC2 |
| InChI | InChI=1S/C31H36N3O3/c1-20-15-24-5-6-25-18-26(22-3-4-22)19-32-31(25)30(29(24)27(16-20)37-2)23-9-11-33(12-10-23)28(35)17-21-7-13-34(36)14-8-21/h7-8,13-16,18-19,22-23,30,36H,3-6,9-12,17H2,1-2H3/q+1 |
| InChIKey | MNLAUPFOIAAVBJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|