C28H31N3O3 — CID 142644996
1-[4-(15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-1-oxidopiperidin-1-ium-1-yl]-2-pyridin-4-ylethanone (PubChem CID 142644996) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 1-[4-(15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-1-oxidopiperidin-1-ium-1-yl]-2-pyridin-4-ylethanone.
| Compound Name | 1-[4-(15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-1-oxidopiperidin-1-ium-1-yl]-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 142644996 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 1-[4-(15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-1-oxidopiperidin-1-ium-1-yl]-2-pyridin-4-ylethanone |
| SMILES | COc1cc(C)cc2c1C(C1CC[N+]([O-])(C(=O)Cc3ccncc3)CC1)c1ncccc1CC2 |
| InChI | InChI=1S/C28H31N3O3/c1-19-16-23-6-5-22-4-3-11-30-28(22)27(26(23)24(17-19)34-2)21-9-14-31(33,15-10-21)25(32)18-20-7-12-29-13-8-20/h3-4,7-8,11-13,16-17,21,27H,5-6,9-10,14-15,18H2,1-2H3 |
| InChIKey | HJFUEWXBDXBQDS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|