C27H29BrN4O4 — CID 18432910
1-[4-(6-bromo-13,15-dimethoxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-4-oxidopiperazin-4-ium-1-yl]-2-pyridin-4-ylethanone (PubChem CID 18432910) has the molecular formula C27H29BrN4O4 and a molecular weight of 553.46 g/mol. Its IUPAC name is 1-[4-(6-bromo-13,15-dimethoxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-4-oxidopiperazin-4-ium-1-yl]-2-pyridin-4-ylethanone.
| Compound Name | 1-[4-(6-bromo-13,15-dimethoxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-4-oxidopiperazin-4-ium-1-yl]-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 18432910 |
| Molecular Formula | C27H29BrN4O4 |
| Molecular Weight | 553.46 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | 1-[4-(6-bromo-13,15-dimethoxy-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-4-oxidopiperazin-4-ium-1-yl]-2-pyridin-4-ylethanone |
| SMILES | COc1cc2c(c(OC)c1)C([N+]1([O-])CCN(C(=O)Cc3ccncc3)CC1)c1ncc(Br)cc1CC2 |
| InChI | InChI=1S/C27H29BrN4O4/c1-35-22-15-19-3-4-20-14-21(28)17-30-26(20)27(25(19)23(16-22)36-2)32(34)11-9-31(10-12-32)24(33)13-18-5-7-29-8-6-18/h5-8,14-17,27H,3-4,9-13H2,1-2H3 |
| InChIKey | RPYOVOSUJHLYIK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|