C28H29BrN3O3+ — CID 22965925
1-[4-(6-bromo-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-(1-hydroxypyridin-1-ium-4-yl)ethanone (PubChem CID 22965925) has the molecular formula C28H29BrN3O3+ and a molecular weight of 535.46 g/mol. Its IUPAC name is 1-[4-(6-bromo-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-(1-hydroxypyridin-1-ium-4-yl)ethanone.
| Compound Name | 1-[4-(6-bromo-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-(1-hydroxypyridin-1-ium-4-yl)ethanone |
|---|---|
| PubChem CID | 22965925 |
| Molecular Formula | C28H29BrN3O3+ |
| Molecular Weight | 535.46 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 1-[4-(6-bromo-15-methoxy-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-(1-hydroxypyridin-1-ium-4-yl)ethanone |
| SMILES | COc1cc(C)cc2c1C(=C1CCN(C(=O)Cc3cc[n+](O)cc3)CC1)c1ncc(Br)cc1CC2 |
| InChI | InChI=1S/C28H29BrN3O3/c1-18-13-21-3-4-22-16-23(29)17-30-28(22)27(26(21)24(14-18)35-2)20-7-9-31(10-8-20)25(33)15-19-5-11-32(34)12-6-19/h5-6,11-14,16-17,34H,3-4,7-10,15H2,1-2H3/q+1 |
| InChIKey | FQHDXAVNQDYCQN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|