C29H29N3O — CID 18715290
1-[4-(6-ethenyl-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone (PubChem CID 18715290) has the molecular formula C29H29N3O and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-[4-(6-ethenyl-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone.
| Compound Name | 1-[4-(6-ethenyl-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 18715290 |
| Molecular Formula | C29H29N3O |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-[4-(6-ethenyl-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone |
| SMILES | C=Cc1cnc2c(c1)CCc1cc(C)ccc1C2=C1CCN(C(=O)Cc2ccncc2)CC1 |
| InChI | InChI=1S/C29H29N3O/c1-3-21-17-25-6-5-24-16-20(2)4-7-26(24)28(29(25)31-19-21)23-10-14-32(15-11-23)27(33)18-22-8-12-30-13-9-22/h3-4,7-9,12-13,16-17,19H,1,5-6,10-11,14-15,18H2,2H3 |
| InChIKey | TUYGCDPZCYNVHO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |