C23H26N2O2 — CID 54538468
2-methoxy-1-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone (PubChem CID 54538468) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-methoxy-1-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone.
| Compound Name | 2-methoxy-1-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 54538468 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-methoxy-1-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone |
| SMILES | COCC(=O)N1CCC(=C2c3ccc(C)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C23H26N2O2/c1-16-5-8-20-19(14-16)7-6-18-4-3-11-24-23(18)22(20)17-9-12-25(13-10-17)21(26)15-27-2/h3-5,8,11,14H,6-7,9-10,12-13,15H2,1-2H3 |
| InChIKey | ZBLBSQYGWCXBDB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |