C23H25N3O3 — CID 19747342
2-[1-(2-methoxyacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carboxamide (PubChem CID 19747342) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-[1-(2-methoxyacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carboxamide.
| Compound Name | 2-[1-(2-methoxyacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carboxamide |
|---|---|
| PubChem CID | 19747342 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[1-(2-methoxyacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carboxamide |
| SMILES | COCC(=O)N1CCC(=C2c3ccc(C(N)=O)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C23H25N3O3/c1-29-14-20(27)26-11-8-15(9-12-26)21-19-7-6-18(23(24)28)13-17(19)5-4-16-3-2-10-25-22(16)21/h2-3,6-7,10,13H,4-5,8-9,11-12,14H2,1H3,(H2,24,28) |
| InChIKey | GLTQANQGKOIBCQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |