C21H22N2O2 — CID 18715440
methyl 2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carboxylate (PubChem CID 18715440) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl 2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carboxylate.
| Compound Name | methyl 2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carboxylate |
|---|---|
| PubChem CID | 18715440 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | methyl 2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-13-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCc1cccnc1C2=C1CCNCC1 |
| InChI | InChI=1S/C21H22N2O2/c1-25-21(24)17-6-7-18-16(13-17)5-4-15-3-2-10-23-20(15)19(18)14-8-11-22-12-9-14/h2-3,6-7,10,13,22H,4-5,8-9,11-12H2,1H3 |
| InChIKey | STLFXEVKHSIPOX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |