C26H22ClN3O3 — CID 163956633
[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 163956633) has the molecular formula C26H22ClN3O3 and a molecular weight of 459.93 g/mol. Its IUPAC name is [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 163956633 |
| Molecular Formula | C26H22ClN3O3 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C26H22ClN3O3/c27-21-7-10-23-20(16-21)4-3-18-2-1-13-28-25(18)24(23)17-11-14-29(15-12-17)26(31)19-5-8-22(9-6-19)30(32)33/h1-2,5-10,13,16H,3-4,11-12,14-15H2 |
| InChIKey | SDXUMOMFBBBSNQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|