C24H21ClN2O2 — CID 67715250
[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(furan-2-yl)methanone (PubChem CID 67715250) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 67715250 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C24H21ClN2O2/c25-19-7-8-20-18(15-19)6-5-17-3-1-11-26-23(17)22(20)16-9-12-27(13-10-16)24(28)21-4-2-14-29-21/h1-4,7-8,11,14-15H,5-6,9-10,12-13H2 |
| InChIKey | ICGQFYLDLDCUJO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |