C25H31ClN4O — CID 170271563
4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)-N-(diethylaminomethyl)piperidine-1-carboxamide (PubChem CID 170271563) has the molecular formula C25H31ClN4O and a molecular weight of 439.00 g/mol. Its IUPAC name is 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)-N-(diethylaminomethyl)piperidine-1-carboxamide.
| Compound Name | 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)-N-(diethylaminomethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 170271563 |
| Molecular Formula | C25H31ClN4O |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)-N-(diethylaminomethyl)piperidine-1-carboxamide |
| SMILES | CCN(CC)CNC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C25H31ClN4O/c1-3-29(4-2)17-28-25(31)30-14-11-18(12-15-30)23-22-10-9-21(26)16-20(22)8-7-19-6-5-13-27-24(19)23/h5-6,9-10,13,16H,3-4,7-8,11-12,14-15,17H2,1-2H3,(H,28,31) |
| InChIKey | PDJQDEIVHHOMPU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|