C29H30N2O5S — CID 19747300
(3,4-dimethoxyphenyl)-[4-(13-methylsulfonyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methanone (PubChem CID 19747300) has the molecular formula C29H30N2O5S and a molecular weight of 518.64 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[4-(13-methylsulfonyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[4-(13-methylsulfonyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 19747300 |
| Molecular Formula | C29H30N2O5S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[4-(13-methylsulfonyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCC(=C3c4ccc(S(C)(=O)=O)cc4CCc4cccnc43)CC2)cc1OC |
| InChI | InChI=1S/C29H30N2O5S/c1-35-25-11-8-22(18-26(25)36-2)29(32)31-15-12-19(13-16-31)27-24-10-9-23(37(3,33)34)17-21(24)7-6-20-5-4-14-30-28(20)27/h4-5,8-11,14,17-18H,6-7,12-13,15-16H2,1-3H3 |
| InChIKey | SGBFYSHYDFJVPY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |