C21H21N3O4S — CID 19747236
[2-(1-cyanopiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl] methyl sulfate (PubChem CID 19747236) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is [2-(1-cyanopiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl] methyl sulfate.
| Compound Name | [2-(1-cyanopiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl] methyl sulfate |
|---|---|
| PubChem CID | 19747236 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [2-(1-cyanopiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl] methyl sulfate |
| SMILES | COS(=O)(=O)Oc1ccc2c(c1)CCc1cccnc1C2=C1CCN(C#N)CC1 |
| InChI | InChI=1S/C21H21N3O4S/c1-27-29(25,26)28-18-6-7-19-17(13-18)5-4-16-3-2-10-23-21(16)20(19)15-8-11-24(14-22)12-9-15/h2-3,6-7,10,13H,4-5,8-9,11-12H2,1H3 |
| InChIKey | RFBDAHBAXOHCSR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|