C26H23ClN4O3 — CID 18715176
1-[4-(13-chloro-14-nitro-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone (PubChem CID 18715176) has the molecular formula C26H23ClN4O3 and a molecular weight of 474.95 g/mol. Its IUPAC name is 1-[4-(13-chloro-14-nitro-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone.
| Compound Name | 1-[4-(13-chloro-14-nitro-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 18715176 |
| Molecular Formula | C26H23ClN4O3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 1-[4-(13-chloro-14-nitro-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone |
| SMILES | O=C(Cc1ccncc1)N1CCC(=C2c3cc([N+](=O)[O-])c(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C26H23ClN4O3/c27-22-15-20-4-3-19-2-1-9-29-26(19)25(21(20)16-23(22)31(33)34)18-7-12-30(13-8-18)24(32)14-17-5-10-28-11-6-17/h1-2,5-6,9-11,15-16H,3-4,7-8,12-14H2 |
| InChIKey | POBURMVLMGQNMU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|