C30H31ClN4O2 — CID 10994871
1-[4-(13-chloro-15,17-dimethyl-4,15-diazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),3(8),4,6,11,13,16-heptaen-2-yl)piperidin-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)ethanone (PubChem CID 10994871) has the molecular formula C30H31ClN4O2 and a molecular weight of 515.06 g/mol. Its IUPAC name is 1-[4-(13-chloro-15,17-dimethyl-4,15-diazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),3(8),4,6,11,13,16-heptaen-2-yl)piperidin-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)ethanone.
| Compound Name | 1-[4-(13-chloro-15,17-dimethyl-4,15-diazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),3(8),4,6,11,13,16-heptaen-2-yl)piperidin-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)ethanone |
|---|---|
| PubChem CID | 10994871 |
| Molecular Formula | C30H31ClN4O2 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 1-[4-(13-chloro-15,17-dimethyl-4,15-diazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),3(8),4,6,11,13,16-heptaen-2-yl)piperidin-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)ethanone |
| SMILES | Cc1cn(C)c2c(Cl)cc3c(c12)C(C1CCN(C(=O)Cc2cc[n+]([O-])cc2)CC1)c1ncccc1CC3 |
| InChI | InChI=1S/C30H31ClN4O2/c1-19-18-33(2)30-24(31)17-23-6-5-22-4-3-11-32-29(22)28(27(23)26(19)30)21-9-12-34(13-10-21)25(36)16-20-7-14-35(37)15-8-20/h3-4,7-8,11,14-15,17-18,21,28H,5-6,9-10,12-13,16H2,1-2H3 |
| InChIKey | IMDFKXWJJPQADE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|