C6H9N — CID 20592628
2,5-dimethyl-3H-pyrrole (PubChem CID 20592628) has the molecular formula C6H9N and a molecular weight of 95.14 g/mol. Its IUPAC name is 2,5-dimethyl-3H-pyrrole.
| Compound Name | 2,5-dimethyl-3H-pyrrole |
|---|---|
| PubChem CID | 20592628 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.14 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | 2,5-dimethyl-3H-pyrrole |
| SMILES | CC1=CCC(C)=N1 |
| InChI | InChI=1S/C6H9N/c1-5-3-4-6(2)7-5/h3H,4H2,1-2H3 |
| InChIKey | FZHMSVPYPPYTOC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 95.14 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |