C21H18O18 — CID 20593255
2-[3,5-bis(1,2-dicarboxyethoxycarbonyl)benzoyl]oxybutanedioic acid (PubChem CID 20593255) has the molecular formula C21H18O18 and a molecular weight of 558.36 g/mol. Its IUPAC name is 2-[3,5-bis(1,2-dicarboxyethoxycarbonyl)benzoyl]oxybutanedioic acid.
| Compound Name | 2-[3,5-bis(1,2-dicarboxyethoxycarbonyl)benzoyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 20593255 |
| Molecular Formula | C21H18O18 |
| Molecular Weight | 558.36 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | 2-[3,5-bis(1,2-dicarboxyethoxycarbonyl)benzoyl]oxybutanedioic acid |
| SMILES | O=C(O)CC(OC(=O)c1cc(C(=O)OC(CC(=O)O)C(=O)O)cc(C(=O)OC(CC(=O)O)C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C21H18O18/c22-13(23)4-10(16(28)29)37-19(34)7-1-8(20(35)38-11(17(30)31)5-14(24)25)3-9(2-7)21(36)39-12(18(32)33)6-15(26)27/h1-3,10-12H,4-6H2,(H,22,23)(H,24,25)(H,26,27)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | BYGDIFHJEPMEOU-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 302.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.36 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|