C18H24O7 — CID 153349547
2-benzoyloxybutanedioic acid;methoxymethane;penta-1,4-diene (PubChem CID 153349547) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is 2-benzoyloxybutanedioic acid;methoxymethane;penta-1,4-diene.
| Compound Name | 2-benzoyloxybutanedioic acid;methoxymethane;penta-1,4-diene |
|---|---|
| PubChem CID | 153349547 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-benzoyloxybutanedioic acid;methoxymethane;penta-1,4-diene |
| SMILES | C=CCC=C.COC.O=C(O)CC(OC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H10O6.C5H8.C2H6O/c12-9(13)6-8(10(14)15)17-11(16)7-4-2-1-3-5-7;1-3-5-4-2;1-3-2/h1-5,8H,6H2,(H,12,13)(H,14,15);3-4H,1-2,5H2;1-2H3 |
| InChIKey | NDBZCORZINAXBZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|