C12H15N5OS3 — CID 2059454
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 2059454) has the molecular formula C12H15N5OS3 and a molecular weight of 341.49 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2059454 |
| Molecular Formula | C12H15N5OS3 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nc(C)cc(C)n2)s1 |
| InChI | InChI=1S/C12H15N5OS3/c1-4-19-12-17-16-11(21-12)15-9(18)6-20-10-13-7(2)5-8(3)14-10/h5H,4,6H2,1-3H3,(H,15,16,18) |
| InChIKey | WQSQNXBIBZGDGI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|