C12H13N7OS2 — CID 2088461
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 2088461) has the molecular formula C12H13N7OS2 and a molecular weight of 335.42 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 2088461 |
| Molecular Formula | C12H13N7OS2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2nc3nc(C)cc(C)n3n2)s1 |
| InChI | InChI=1S/C12H13N7OS2/c1-4-21-12-17-16-11(22-12)15-9(20)8-14-10-13-6(2)5-7(3)19(10)18-8/h5H,4H2,1-3H3,(H,15,16,20) |
| InChIKey | OSJIHZZCXQYIBZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|