About CID 20595712
CID 20595712 (PubChem CID 20595712) has the molecular formula C25H37BN2O4
and a molecular weight of 440.39 g/mol.
Molecular Properties
| Compound Name | CID 20595712 |
| PubChem CID | 20595712 |
| Molecular Formula | C25H37BN2O4 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1C(Cc2ccccc2)C(CC2CC(O)CCC2C(=O)NC(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C25H37BN2O4/c1-24(2,3)27-22(30)19-12-11-18(29)14-17(19)15-21-20(13-16-9-7-6-8-10-16)28(23(26)31)25(4,5)32-21/h6-10,17-21,29H,11-15H2,1-5H3,(H,27,30) |
| InChIKey | PGNIZTHCAPJURC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20595712 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20595712?
The IUPAC name of CID 20595712 (CID 20595712) is not available.
What is the SMILES notation for CID 20595712?
The canonical SMILES for CID 20595712 is [B]C(=O)N1C(Cc2ccccc2)C(CC2CC(O)CCC2C(=O)NC(C)(C)C)OC1(C)C.
What is the InChIKey of CID 20595712?
The InChIKey is PGNIZTHCAPJURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H37BN2O4/c1-24(2,3)27-22(30)19-12-11-18(29)14-17(19)15-21-20(13-16-9-7-6-8-10-16)28(23(26)31)25(4,5)32-21/h6-10,17-21,29H,11-15H2,1-5H3,(H,27,30).
What are the key properties of CID 20595712?
CID 20595712 has a molecular weight of 440.39 g/mol, XLogP of 3.41, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20595712 is sourced from PubChem (CID 20595712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).