C14H16BNO4 — CID 20595767
CID 20595767 (PubChem CID 20595767) has the molecular formula C14H16BNO4 and a molecular weight of 273.10 g/mol.
| Compound Name | CID 20595767 |
|---|---|
| PubChem CID | 20595767 |
| Molecular Formula | C14H16BNO4 |
| Molecular Weight | 273.10 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NC(Cc1ccccc1)C(=O)CC(=O)OCC |
| InChI | InChI=1S/C14H16BNO4/c1-2-20-13(18)9-12(17)11(16-14(15)19)8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,16,19) |
| InChIKey | FTMVQDNWNBMPSY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.10 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|