C19H25N3O5 — CID 20596037
2-[[1-carboxy-2-[3-(phenylmethoxymethyl)imidazol-4-yl]ethyl]amino]pentanoic acid (PubChem CID 20596037) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-[[1-carboxy-2-[3-(phenylmethoxymethyl)imidazol-4-yl]ethyl]amino]pentanoic acid.
| Compound Name | 2-[[1-carboxy-2-[3-(phenylmethoxymethyl)imidazol-4-yl]ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 20596037 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-[[1-carboxy-2-[3-(phenylmethoxymethyl)imidazol-4-yl]ethyl]amino]pentanoic acid |
| SMILES | CCCC(NC(Cc1cncn1COCc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H25N3O5/c1-2-6-16(18(23)24)21-17(19(25)26)9-15-10-20-12-22(15)13-27-11-14-7-4-3-5-8-14/h3-5,7-8,10,12,16-17,21H,2,6,9,11,13H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | CTRBQBQNEWISMJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |