C18H23N3O3 — CID 90969843
(2S)-3-(3-benzylimidazol-4-yl)-2-(prop-2-enoylamino)propanoic acid;ethane (PubChem CID 90969843) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2S)-3-(3-benzylimidazol-4-yl)-2-(prop-2-enoylamino)propanoic acid;ethane.
| Compound Name | (2S)-3-(3-benzylimidazol-4-yl)-2-(prop-2-enoylamino)propanoic acid;ethane |
|---|---|
| PubChem CID | 90969843 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2S)-3-(3-benzylimidazol-4-yl)-2-(prop-2-enoylamino)propanoic acid;ethane |
| SMILES | C=CC(=O)N[C@@H](Cc1cncn1Cc1ccccc1)C(=O)O.CC |
| InChI | InChI=1S/C16H17N3O3.C2H6/c1-2-15(20)18-14(16(21)22)8-13-9-17-11-19(13)10-12-6-4-3-5-7-12;1-2/h2-7,9,11,14H,1,8,10H2,(H,18,20)(H,21,22);1-2H3/t14-;/m0./s1 |
| InChIKey | SEGOYUTZWIIJGV-UQKRIMTDSA-N |
| XLogP | 2.26 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|