C19H14F3N3OS — CID 20597448
3-(pyrazin-2-ylsulfanylmethyl)-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 20597448) has the molecular formula C19H14F3N3OS and a molecular weight of 389.40 g/mol. Its IUPAC name is 3-(pyrazin-2-ylsulfanylmethyl)-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(pyrazin-2-ylsulfanylmethyl)-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 20597448 |
| Molecular Formula | C19H14F3N3OS |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-(pyrazin-2-ylsulfanylmethyl)-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cccc(CSc2cnccn2)c1 |
| InChI | InChI=1S/C19H14F3N3OS/c20-19(21,22)15-4-6-16(7-5-15)25-18(26)14-3-1-2-13(10-14)12-27-17-11-23-8-9-24-17/h1-11H,12H2,(H,25,26) |
| InChIKey | OZFKPRWTKMHIMC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |