C28H38N2O6S — CID 20599284
[3-[[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-6-ethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carbonyl]amino]-2-methylphenyl] hydrogen sulfate (PubChem CID 20599284) has the molecular formula C28H38N2O6S and a molecular weight of 530.69 g/mol. Its IUPAC name is [3-[[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-6-ethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carbonyl]amino]-2-methylphenyl] hydrogen sulfate.
| Compound Name | [3-[[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-6-ethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carbonyl]amino]-2-methylphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 20599284 |
| Molecular Formula | C28H38N2O6S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | [3-[[(1S,3aS,3bS,5aR,9aR,9bS,11aS)-6-ethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carbonyl]amino]-2-methylphenyl] hydrogen sulfate |
| SMILES | CCN1C(=O)C=C[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](C(=O)Nc5cccc(OS(=O)(=O)O)c5C)CC[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C28H38N2O6S/c1-5-30-24-12-9-18-19-10-11-21(27(19,3)15-13-20(18)28(24,4)16-14-25(30)31)26(32)29-22-7-6-8-23(17(22)2)36-37(33,34)35/h6-8,14,16,18-21,24H,5,9-13,15H2,1-4H3,(H,29,32)(H,33,34,35)/t18-,19-,20-,21+,24+,27-,28+/m0/s1 |
| InChIKey | NUVZYBBXGQVNBN-VLKUPPSBSA-N |
| XLogP | 4.76 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|