C30H41N3O4 — CID 68670366
aminomethyl 2-[[2-[(1R,3aS,3bS,5aR,9aR,9bS,11aR)-6-ethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]acetyl]amino]benzoate (PubChem CID 68670366) has the molecular formula C30H41N3O4 and a molecular weight of 507.68 g/mol. Its IUPAC name is aminomethyl 2-[[2-[(1R,3aS,3bS,5aR,9aR,9bS,11aR)-6-ethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]acetyl]amino]benzoate.
| Compound Name | aminomethyl 2-[[2-[(1R,3aS,3bS,5aR,9aR,9bS,11aR)-6-ethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 68670366 |
| Molecular Formula | C30H41N3O4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | aminomethyl 2-[[2-[(1R,3aS,3bS,5aR,9aR,9bS,11aR)-6-ethyl-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]acetyl]amino]benzoate |
| SMILES | CCN1C(=O)C=C[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](CC(=O)Nc5ccccc5C(=O)OCN)CC[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C30H41N3O4/c1-4-33-25-12-10-20-22-11-9-19(29(22,2)15-13-23(20)30(25,3)16-14-27(33)35)17-26(34)32-24-8-6-5-7-21(24)28(36)37-18-31/h5-8,14,16,19-20,22-23,25H,4,9-13,15,17-18,31H2,1-3H3,(H,32,34)/t19-,20+,22+,23+,25-,29-,30-/m1/s1 |
| InChIKey | MPRYQPGFFLFGRQ-TVVRWKCHSA-N |
| XLogP | 4.73 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|