C19H18O6 — CID 20599428
4-[2-formyl-4-[(4-methylphenyl)methoxy]phenoxy]-4-oxobutanoic acid (PubChem CID 20599428) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-[2-formyl-4-[(4-methylphenyl)methoxy]phenoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-formyl-4-[(4-methylphenyl)methoxy]phenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20599428 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 4-[2-formyl-4-[(4-methylphenyl)methoxy]phenoxy]-4-oxobutanoic acid |
| SMILES | Cc1ccc(COc2ccc(OC(=O)CCC(=O)O)c(C=O)c2)cc1 |
| InChI | InChI=1S/C19H18O6/c1-13-2-4-14(5-3-13)12-24-16-6-7-17(15(10-16)11-20)25-19(23)9-8-18(21)22/h2-7,10-11H,8-9,12H2,1H3,(H,21,22) |
| InChIKey | YGVMUMFYJMZXEI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|