C19H18O8 — CID 20599431
4-[[4-(4,4-dihydroxybutanoyloxy)-3-formylphenoxy]methyl]benzoic acid (PubChem CID 20599431) has the molecular formula C19H18O8 and a molecular weight of 374.35 g/mol. Its IUPAC name is 4-[[4-(4,4-dihydroxybutanoyloxy)-3-formylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-(4,4-dihydroxybutanoyloxy)-3-formylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 20599431 |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-[[4-(4,4-dihydroxybutanoyloxy)-3-formylphenoxy]methyl]benzoic acid |
| SMILES | O=Cc1cc(OCc2ccc(C(=O)O)cc2)ccc1OC(=O)CCC(O)O |
| InChI | InChI=1S/C19H18O8/c20-10-14-9-15(5-6-16(14)27-18(23)8-7-17(21)22)26-11-12-1-3-13(4-2-12)19(24)25/h1-6,9-10,17,21-22H,7-8,11H2,(H,24,25) |
| InChIKey | QWKSPQKZTSWKTF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|