C31H24O8 — CID 59154492
4-[[4-[[4-[(4-carboxyphenyl)methoxy]-3-formylphenyl]methyl]-2-formylphenoxy]methyl]benzoic acid (PubChem CID 59154492) has the molecular formula C31H24O8 and a molecular weight of 524.53 g/mol. Its IUPAC name is 4-[[4-[[4-[(4-carboxyphenyl)methoxy]-3-formylphenyl]methyl]-2-formylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[[4-[(4-carboxyphenyl)methoxy]-3-formylphenyl]methyl]-2-formylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 59154492 |
| Molecular Formula | C31H24O8 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 4-[[4-[[4-[(4-carboxyphenyl)methoxy]-3-formylphenyl]methyl]-2-formylphenoxy]methyl]benzoic acid |
| SMILES | O=Cc1cc(Cc2ccc(OCc3ccc(C(=O)O)cc3)c(C=O)c2)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C31H24O8/c32-16-26-14-22(5-11-28(26)38-18-20-1-7-24(8-2-20)30(34)35)13-23-6-12-29(27(15-23)17-33)39-19-21-3-9-25(10-4-21)31(36)37/h1-12,14-17H,13,18-19H2,(H,34,35)(H,36,37) |
| InChIKey | HIZRCVOJQWTKFM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|