C23H38F2O3 — CID 20599463
2-(2,2-difluoroethenyl)-5-[4-[3-(4-methoxycyclohexyl)propoxy]cyclohexyl]oxane (PubChem CID 20599463) has the molecular formula C23H38F2O3 and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-(2,2-difluoroethenyl)-5-[4-[3-(4-methoxycyclohexyl)propoxy]cyclohexyl]oxane.
| Compound Name | 2-(2,2-difluoroethenyl)-5-[4-[3-(4-methoxycyclohexyl)propoxy]cyclohexyl]oxane |
|---|---|
| PubChem CID | 20599463 |
| Molecular Formula | C23H38F2O3 |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 2-(2,2-difluoroethenyl)-5-[4-[3-(4-methoxycyclohexyl)propoxy]cyclohexyl]oxane |
| SMILES | COC1CCC(CCCOC2CCC(C3CCC(C=C(F)F)OC3)CC2)CC1 |
| InChI | InChI=1S/C23H38F2O3/c1-26-20-9-4-17(5-10-20)3-2-14-27-21-11-6-18(7-12-21)19-8-13-22(28-16-19)15-23(24)25/h15,17-22H,2-14,16H2,1H3 |
| InChIKey | YONQKDBHIGMIKJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|