C27H44F2O — CID 20599971
5-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]butyl]cyclohexyl]-2-[(E)-prop-1-enyl]oxane (PubChem CID 20599971) has the molecular formula C27H44F2O and a molecular weight of 422.64 g/mol. Its IUPAC name is 5-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]butyl]cyclohexyl]-2-[(E)-prop-1-enyl]oxane.
| Compound Name | 5-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]butyl]cyclohexyl]-2-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 20599971 |
| Molecular Formula | C27H44F2O |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | 5-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]butyl]cyclohexyl]-2-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/C1CCC(C2CCC(CCCCC3CCC(CC=C(F)F)CC3)CC2)CO1 |
| InChI | InChI=1S/C27H44F2O/c1-2-5-26-18-17-25(20-30-26)24-15-12-22(13-16-24)7-4-3-6-21-8-10-23(11-9-21)14-19-27(28)29/h2,5,19,21-26H,3-4,6-18,20H2,1H3/b5-2+ |
| InChIKey | NDZPGJWNCQPBDK-GORDUTHDSA-N |
| XLogP | 8.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|