C15H14F6N4 — CID 20601380
1-N,2-N-bis[5-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine (PubChem CID 20601380) has the molecular formula C15H14F6N4 and a molecular weight of 364.29 g/mol. Its IUPAC name is 1-N,2-N-bis[5-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine.
| Compound Name | 1-N,2-N-bis[5-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 20601380 |
| Molecular Formula | C15H14F6N4 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-N,2-N-bis[5-(trifluoromethyl)-2-pyridinyl]propane-1,2-diamine |
| SMILES | CC(CNc1ccc(C(F)(F)F)cn1)Nc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H14F6N4/c1-9(25-13-5-3-11(8-24-13)15(19,20)21)6-22-12-4-2-10(7-23-12)14(16,17)18/h2-5,7-9H,6H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | HOQAOGNHCQOKNC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |