C12H17NS — CID 20603575
(2E,5E)-N,N-dimethyl-6-thiophen-2-ylhexa-2,5-dien-1-amine (PubChem CID 20603575) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is (2E,5E)-N,N-dimethyl-6-thiophen-2-ylhexa-2,5-dien-1-amine.
| Compound Name | (2E,5E)-N,N-dimethyl-6-thiophen-2-ylhexa-2,5-dien-1-amine |
|---|---|
| PubChem CID | 20603575 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (2E,5E)-N,N-dimethyl-6-thiophen-2-ylhexa-2,5-dien-1-amine |
| SMILES | CN(C)C/C=C/C/C=C/c1cccs1 |
| InChI | InChI=1S/C12H17NS/c1-13(2)10-6-4-3-5-8-12-9-7-11-14-12/h4-9,11H,3,10H2,1-2H3/b6-4+,8-5+ |
| InChIKey | FVEQANWUVLJILY-HLQBBKRNSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|