C17H17N5S — CID 20604298
6-(4-aminophenyl)sulfanyl-N-(5-cyclopropyl-1H-pyrazol-3-yl)pyridin-2-amine (PubChem CID 20604298) has the molecular formula C17H17N5S and a molecular weight of 323.43 g/mol. Its IUPAC name is 6-(4-aminophenyl)sulfanyl-N-(5-cyclopropyl-1H-pyrazol-3-yl)pyridin-2-amine.
| Compound Name | 6-(4-aminophenyl)sulfanyl-N-(5-cyclopropyl-1H-pyrazol-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 20604298 |
| Molecular Formula | C17H17N5S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 6-(4-aminophenyl)sulfanyl-N-(5-cyclopropyl-1H-pyrazol-3-yl)pyridin-2-amine |
| SMILES | Nc1ccc(Sc2cccc(Nc3cc(C4CC4)[nH]n3)n2)cc1 |
| InChI | InChI=1S/C17H17N5S/c18-12-6-8-13(9-7-12)23-17-3-1-2-15(20-17)19-16-10-14(21-22-16)11-4-5-11/h1-3,6-11H,4-5,18H2,(H2,19,20,21,22) |
| InChIKey | QYARQXDZRFCLME-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|