C18H19N5 — CID 90243458
N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(3-ethylphenyl)pyrimidin-4-amine (PubChem CID 90243458) has the molecular formula C18H19N5 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(3-ethylphenyl)pyrimidin-4-amine.
| Compound Name | N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(3-ethylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 90243458 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-(5-cyclopropyl-1H-pyrazol-3-yl)-2-(3-ethylphenyl)pyrimidin-4-amine |
| SMILES | CCc1cccc(-c2nccc(Nc3cc(C4CC4)[nH]n3)n2)c1 |
| InChI | InChI=1S/C18H19N5/c1-2-12-4-3-5-14(10-12)18-19-9-8-16(21-18)20-17-11-15(22-23-17)13-6-7-13/h3-5,8-11,13H,2,6-7H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | OMOXGUOUDIZCIX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |