C13H16N6O2S — CID 58169227
(E)-3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]prop-2-ene-1-sulfonamide (PubChem CID 58169227) has the molecular formula C13H16N6O2S and a molecular weight of 320.38 g/mol. Its IUPAC name is (E)-3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]prop-2-ene-1-sulfonamide.
| Compound Name | (E)-3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 58169227 |
| Molecular Formula | C13H16N6O2S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (E)-3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]prop-2-ene-1-sulfonamide |
| SMILES | NS(=O)(=O)C/C=C/c1nccc(Nc2cc(C3CC3)[nH]n2)n1 |
| InChI | InChI=1S/C13H16N6O2S/c14-22(20,21)7-1-2-11-15-6-5-12(16-11)17-13-8-10(18-19-13)9-3-4-9/h1-2,5-6,8-9H,3-4,7H2,(H2,14,20,21)(H2,15,16,17,18,19)/b2-1+ |
| InChIKey | DHWLPIZKGPVMOP-OWOJBTEDSA-N |
| XLogP | 1.12 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |