C13H14N5O2S- — CID 77491619
3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]prop-2-ene-1-sulfinate (PubChem CID 77491619) has the molecular formula C13H14N5O2S- and a molecular weight of 304.36 g/mol. Its IUPAC name is 3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]prop-2-ene-1-sulfinate.
| Compound Name | 3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]prop-2-ene-1-sulfinate |
|---|---|
| PubChem CID | 77491619 |
| Molecular Formula | C13H14N5O2S- |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3-[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]prop-2-ene-1-sulfinate |
| SMILES | O=S([O-])CC=Cc1nccc(Nc2cc(C3CC3)[nH]n2)n1 |
| InChI | InChI=1S/C13H15N5O2S/c19-21(20)7-1-2-11-14-6-5-12(15-11)16-13-8-10(17-18-13)9-3-4-9/h1-2,5-6,8-9H,3-4,7H2,(H,19,20)(H2,14,15,16,17,18)/p-1 |
| InChIKey | XMBJMWKXRDSRMD-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|