About 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran
4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran (PubChem CID 20605808) has the molecular formula C7H12S2
and a molecular weight of 160.31 g/mol. Its IUPAC name is 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran.
Analyze 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran?
The IUPAC name of 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran (CID 20605808) is 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran.
What is the SMILES notation for 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran?
The canonical SMILES for 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran is CSC1=C(C)CCSC1.
What is the InChIKey of 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran?
The InChIKey is XWLDACOZGFPKNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12S2/c1-6-3-4-9-5-7(6)8-2/h3-5H2,1-2H3.
What are the key properties of 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran?
4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran has a molecular weight of 160.31 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-methylsulfanyl-3,6-dihydro-2H-thiopyran is sourced from PubChem (CID 20605808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).