C18H17ClN6O — CID 20609838
2-chloro-N-[[6-(furan-2-yl)-3-pyridinyl]methyl]-9-propan-2-ylpurin-6-amine (PubChem CID 20609838) has the molecular formula C18H17ClN6O and a molecular weight of 368.83 g/mol. Its IUPAC name is 2-chloro-N-[[6-(furan-2-yl)-3-pyridinyl]methyl]-9-propan-2-ylpurin-6-amine.
| Compound Name | 2-chloro-N-[[6-(furan-2-yl)-3-pyridinyl]methyl]-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 20609838 |
| Molecular Formula | C18H17ClN6O |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-chloro-N-[[6-(furan-2-yl)-3-pyridinyl]methyl]-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1cnc2c(NCc3ccc(-c4ccco4)nc3)nc(Cl)nc21 |
| InChI | InChI=1S/C18H17ClN6O/c1-11(2)25-10-22-15-16(23-18(19)24-17(15)25)21-9-12-5-6-13(20-8-12)14-4-3-7-26-14/h3-8,10-11H,9H2,1-2H3,(H,21,23,24) |
| InChIKey | VTDUOCHVLWSVJG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |